About [4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea
[4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea (PubChem CID 15753006) has the molecular formula C19H24N2OS
and a molecular weight of 328.48 g/mol. Its IUPAC name is [4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea.
Molecular Properties
| Compound Name | [4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea |
| PubChem CID | 15753006 |
| Molecular Formula | C19H24N2OS |
| Molecular Weight | 328.48 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | [4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea |
| SMILES | CC(C)c1cc(Oc2ccccc2)cc(C(C)C)c1NC(N)=S |
| InChI | InChI=1S/C19H24N2OS/c1-12(2)16-10-15(22-14-8-6-5-7-9-14)11-17(13(3)4)18(16)21-19(20)23/h5-13H,1-4H3,(H3,20,21,23) |
| InChIKey | RBDFBEPKVUICAS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 328.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea?
The IUPAC name of [4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea (CID 15753006) is [4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea.
What is the SMILES notation for [4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea?
The canonical SMILES for [4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea is CC(C)c1cc(Oc2ccccc2)cc(C(C)C)c1NC(N)=S.
What is the InChIKey of [4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea?
The InChIKey is RBDFBEPKVUICAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2OS/c1-12(2)16-10-15(22-14-8-6-5-7-9-14)11-17(13(3)4)18(16)21-19(20)23/h5-13H,1-4H3,(H3,20,21,23).
What are the key properties of [4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea?
[4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea has a molecular weight of 328.48 g/mol, XLogP of 5.38, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-phenoxy-2,6-di(propan-2-yl)phenyl]thiourea is sourced from PubChem (CID 15753006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).