About 1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione
1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione (PubChem CID 15754107) has the molecular formula C9H12O3S2
and a molecular weight of 232.33 g/mol. Its IUPAC name is 1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione.
Molecular Properties
| Compound Name | 1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione |
| PubChem CID | 15754107 |
| Molecular Formula | C9H12O3S2 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.02 |
| IUPAC Name | 1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione |
| SMILES | O=C1CC(=O)OC2(CSCCSC2)C1 |
| InChI | InChI=1S/C9H12O3S2/c10-7-3-8(11)12-9(4-7)5-13-1-2-14-6-9/h1-6H2 |
| InChIKey | ZHFFVIAQMLCOBI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione?
The IUPAC name of 1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione (CID 15754107) is 1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione.
What is the SMILES notation for 1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione?
The canonical SMILES for 1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione is O=C1CC(=O)OC2(CSCCSC2)C1.
What is the InChIKey of 1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione?
The InChIKey is ZHFFVIAQMLCOBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3S2/c10-7-3-8(11)12-9(4-7)5-13-1-2-14-6-9/h1-6H2.
What are the key properties of 1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione?
1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione has a molecular weight of 232.33 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxa-8,11-dithiaspiro[5.6]dodecane-2,4-dione is sourced from PubChem (CID 15754107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).