C32H40N2O2 — CID 15754546
2-adamantyl N-[(2R)-1-(1H-indol-3-yl)-2-methyl-6-phenylhexan-2-yl]carbamate (PubChem CID 15754546) has the molecular formula C32H40N2O2 and a molecular weight of 484.68 g/mol. Its IUPAC name is 2-adamantyl N-[(2R)-1-(1H-indol-3-yl)-2-methyl-6-phenylhexan-2-yl]carbamate.
| Compound Name | 2-adamantyl N-[(2R)-1-(1H-indol-3-yl)-2-methyl-6-phenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 15754546 |
| Molecular Formula | C32H40N2O2 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.31 |
| IUPAC Name | 2-adamantyl N-[(2R)-1-(1H-indol-3-yl)-2-methyl-6-phenylhexan-2-yl]carbamate |
| SMILES | C[C@@](CCCCc1ccccc1)(Cc1c[nH]c2ccccc12)NC(=O)OC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C32H40N2O2/c1-32(14-8-7-11-22-9-3-2-4-10-22,20-27-21-33-29-13-6-5-12-28(27)29)34-31(35)36-30-25-16-23-15-24(18-25)19-26(30)17-23/h2-6,9-10,12-13,21,23-26,30,33H,7-8,11,14-20H2,1H3,(H,34,35)/t23?,24?,25?,26?,30?,32-/m1/s1 |
| InChIKey | HJWDJTOGNAACSO-PVQYRTRSSA-N |
| XLogP | 7.43 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|