C11H18O3 — CID 15755829
3-[(1E,3E,5E)-octa-1,3,5-trienoxy]propane-1,2-diol (PubChem CID 15755829) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is 3-[(1E,3E,5E)-octa-1,3,5-trienoxy]propane-1,2-diol.
| Compound Name | 3-[(1E,3E,5E)-octa-1,3,5-trienoxy]propane-1,2-diol |
|---|---|
| PubChem CID | 15755829 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | 3-[(1E,3E,5E)-octa-1,3,5-trienoxy]propane-1,2-diol |
| SMILES | CC/C=C/C=C/C=C/OCC(O)CO |
| InChI | InChI=1S/C11H18O3/c1-2-3-4-5-6-7-8-14-10-11(13)9-12/h3-8,11-13H,2,9-10H2,1H3/b4-3+,6-5+,8-7+ |
| InChIKey | DIVUFFKQRPTNII-ARQDATDDSA-N |
| XLogP | 1.39 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|