C14H24O2 — CID 15758095
3,5-ditert-butylcyclohexa-3,5-diene-1,2-diol (PubChem CID 15758095) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 3,5-ditert-butylcyclohexa-3,5-diene-1,2-diol.
| Compound Name | 3,5-ditert-butylcyclohexa-3,5-diene-1,2-diol |
|---|---|
| PubChem CID | 15758095 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 3,5-ditert-butylcyclohexa-3,5-diene-1,2-diol |
| SMILES | CC(C)(C)C1=CC(O)C(O)C(C(C)(C)C)=C1 |
| InChI | InChI=1S/C14H24O2/c1-13(2,3)9-7-10(14(4,5)6)12(16)11(15)8-9/h7-8,11-12,15-16H,1-6H3 |
| InChIKey | YXFDTQFVZMEVHV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |