About 5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene
5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene (PubChem CID 15759017) has the molecular formula C9H6F8
and a molecular weight of 266.13 g/mol. Its IUPAC name is 5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
| PubChem CID | 15759017 |
| Molecular Formula | C9H6F8 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene |
| SMILES | FC(F)(F)C1(F)C2C=CC(C2)C1(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F8/c10-6(8(12,13)14)4-1-2-5(3-4)7(6,11)9(15,16)17/h1-2,4-5H,3H2 |
| InChIKey | PQHHGTDOGKMDGU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene?
The IUPAC name of 5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene (CID 15759017) is 5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene is FC(F)(F)C1(F)C2C=CC(C2)C1(F)C(F)(F)F.
What is the InChIKey of 5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene?
The InChIKey is PQHHGTDOGKMDGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6F8/c10-6(8(12,13)14)4-1-2-5(3-4)7(6,11)9(15,16)17/h1-2,4-5H,3H2.
What are the key properties of 5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene?
5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene has a molecular weight of 266.13 g/mol, XLogP of 3.73, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-difluoro-5,6-bis(trifluoromethyl)bicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 15759017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).