C14H30Si3 — CID 15759146
trimethyl-(2,3,4,5-tetramethyl-1-trimethylsilylsilol-1-yl)silane (PubChem CID 15759146) has the molecular formula C14H30Si3 and a molecular weight of 282.65 g/mol. Its IUPAC name is trimethyl-(2,3,4,5-tetramethyl-1-trimethylsilylsilol-1-yl)silane.
| Compound Name | trimethyl-(2,3,4,5-tetramethyl-1-trimethylsilylsilol-1-yl)silane |
|---|---|
| PubChem CID | 15759146 |
| Molecular Formula | C14H30Si3 |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | trimethyl-(2,3,4,5-tetramethyl-1-trimethylsilylsilol-1-yl)silane |
| SMILES | CC1=C(C)[Si]([Si](C)(C)C)([Si](C)(C)C)C(C)=C1C |
| InChI | InChI=1S/C14H30Si3/c1-11-12(2)14(4)17(13(11)3,15(5,6)7)16(8,9)10/h1-10H3 |
| InChIKey | KMPFTECIQLFMBW-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|