About CID 15759174
CID 15759174 (PubChem CID 15759174) has the molecular formula C12H19GeLi
and a molecular weight of 242.84 g/mol.
Molecular Properties
| Compound Name | CID 15759174 |
| PubChem CID | 15759174 |
| Molecular Formula | C12H19GeLi |
| Molecular Weight | 242.84 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | — |
| SMILES | CC(C)[Ge](c1ccccc1)C(C)C.[Li] |
| InChI | InChI=1S/C12H19Ge.Li/c1-10(2)13(11(3)4)12-8-6-5-7-9-12;/h5-11H,1-4H3; |
| InChIKey | WEIPXDUHIQSDJX-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.84 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 15759174 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15759174?
The IUPAC name of CID 15759174 (CID 15759174) is not available.
What is the SMILES notation for CID 15759174?
The canonical SMILES for CID 15759174 is CC(C)[Ge](c1ccccc1)C(C)C.[Li].
What is the InChIKey of CID 15759174?
The InChIKey is WEIPXDUHIQSDJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19Ge.Li/c1-10(2)13(11(3)4)12-8-6-5-7-9-12;/h5-11H,1-4H3;.
What are the key properties of CID 15759174?
CID 15759174 has a molecular weight of 242.84 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15759174 is sourced from PubChem (CID 15759174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).