C9H12F3NO2S — CID 15759319
N-[[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1,1,1-trifluoromethanesulfonamide (PubChem CID 15759319) has the molecular formula C9H12F3NO2S and a molecular weight of 255.26 g/mol. Its IUPAC name is N-[[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1,1,1-trifluoromethanesulfonamide.
| Compound Name | N-[[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1,1,1-trifluoromethanesulfonamide |
|---|---|
| PubChem CID | 15759319 |
| Molecular Formula | C9H12F3NO2S |
| Molecular Weight | 255.26 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | N-[[(1S,2R,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1,1,1-trifluoromethanesulfonamide |
| SMILES | O=S(=O)(NC[C@@H]1C[C@H]2C=C[C@@H]1C2)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO2S/c10-9(11,12)16(14,15)13-5-8-4-6-1-2-7(8)3-6/h1-2,6-8,13H,3-5H2/t6-,7+,8-/m0/s1 |
| InChIKey | GTKQRIPEBBDJIN-RNJXMRFFSA-N |
| XLogP | 1.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.26 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|