C19H12Br2O2 — CID 15760225
1,4-dibromo-7,7-diphenylbicyclo[4.1.0]hept-3-ene-2,5-dione (PubChem CID 15760225) has the molecular formula C19H12Br2O2 and a molecular weight of 432.11 g/mol. Its IUPAC name is 1,4-dibromo-7,7-diphenylbicyclo[4.1.0]hept-3-ene-2,5-dione.
| Compound Name | 1,4-dibromo-7,7-diphenylbicyclo[4.1.0]hept-3-ene-2,5-dione |
|---|---|
| PubChem CID | 15760225 |
| Molecular Formula | C19H12Br2O2 |
| Molecular Weight | 432.11 g/mol |
| Exact Mass | 429.92 |
| IUPAC Name | 1,4-dibromo-7,7-diphenylbicyclo[4.1.0]hept-3-ene-2,5-dione |
| SMILES | O=C1C(Br)=CC(=O)C2(Br)C1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H12Br2O2/c20-14-11-15(22)19(21)17(16(14)23)18(19,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-11,17H |
| InChIKey | XRDDNQUDOQPWMB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.11 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|