About 1,1-Dimethyl-4-trimethylsilyl-5-phenyl-3-(o-tolyl)-1,3-disila-4-cyclopentene
1,1-Dimethyl-4-trimethylsilyl-5-phenyl-3-(o-tolyl)-1,3-disila-4-cyclopentene (PubChem CID 15760241) has the molecular formula C21H29Si3
and a molecular weight of 365.72 g/mol.
Molecular Properties
| Compound Name | 1,1-Dimethyl-4-trimethylsilyl-5-phenyl-3-(o-tolyl)-1,3-disila-4-cyclopentene |
| PubChem CID | 15760241 |
| Molecular Formula | C21H29Si3 |
| Molecular Weight | 365.72 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | — |
| SMILES | Cc1ccccc1[Si]1C[Si](C)(C)C(c2ccccc2)=C1[Si](C)(C)C |
| InChI | InChI=1S/C21H29Si3/c1-17-12-10-11-15-19(17)22-16-24(5,6)20(21(22)23(2,3)4)18-13-8-7-9-14-18/h7-15H,16H2,1-6H3 |
| InChIKey | ZSQGRONXDSHYGU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.72 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,1-Dimethyl-4-trimethylsilyl-5-phenyl-3-(o-tolyl)-1,3-disila-4-cyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-Dimethyl-4-trimethylsilyl-5-phenyl-3-(o-tolyl)-1,3-disila-4-cyclopentene?
The IUPAC name of 1,1-Dimethyl-4-trimethylsilyl-5-phenyl-3-(o-tolyl)-1,3-disila-4-cyclopentene (CID 15760241) is not available.
What is the SMILES notation for 1,1-Dimethyl-4-trimethylsilyl-5-phenyl-3-(o-tolyl)-1,3-disila-4-cyclopentene?
The canonical SMILES for 1,1-Dimethyl-4-trimethylsilyl-5-phenyl-3-(o-tolyl)-1,3-disila-4-cyclopentene is Cc1ccccc1[Si]1C[Si](C)(C)C(c2ccccc2)=C1[Si](C)(C)C.
What is the InChIKey of 1,1-Dimethyl-4-trimethylsilyl-5-phenyl-3-(o-tolyl)-1,3-disila-4-cyclopentene?
The InChIKey is ZSQGRONXDSHYGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29Si3/c1-17-12-10-11-15-19(17)22-16-24(5,6)20(21(22)23(2,3)4)18-13-8-7-9-14-18/h7-15H,16H2,1-6H3.
What are the key properties of 1,1-Dimethyl-4-trimethylsilyl-5-phenyl-3-(o-tolyl)-1,3-disila-4-cyclopentene?
1,1-Dimethyl-4-trimethylsilyl-5-phenyl-3-(o-tolyl)-1,3-disila-4-cyclopentene has a molecular weight of 365.72 g/mol, XLogP of 5.37, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-Dimethyl-4-trimethylsilyl-5-phenyl-3-(o-tolyl)-1,3-disila-4-cyclopentene is sourced from PubChem (CID 15760241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).