About 4,6-diiodopyrimidine
4,6-diiodopyrimidine (PubChem CID 15760295) has the molecular formula C4H2I2N2
and a molecular weight of 331.88 g/mol. Its IUPAC name is 4,6-diiodopyrimidine.
Molecular Properties
| Compound Name | 4,6-diiodopyrimidine |
| PubChem CID | 15760295 |
| Molecular Formula | C4H2I2N2 |
| Molecular Weight | 331.88 g/mol |
| Exact Mass | 331.83 |
| IUPAC Name | 4,6-diiodopyrimidine |
| SMILES | Ic1cc(I)ncn1 |
| InChI | InChI=1S/C4H2I2N2/c5-3-1-4(6)8-2-7-3/h1-2H |
| InChIKey | LBVUFZJYMWUZIW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.88 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4,6-diiodopyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diiodopyrimidine?
The IUPAC name of 4,6-diiodopyrimidine (CID 15760295) is 4,6-diiodopyrimidine.
What is the SMILES notation for 4,6-diiodopyrimidine?
The canonical SMILES for 4,6-diiodopyrimidine is Ic1cc(I)ncn1.
What is the InChIKey of 4,6-diiodopyrimidine?
The InChIKey is LBVUFZJYMWUZIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2I2N2/c5-3-1-4(6)8-2-7-3/h1-2H.
What are the key properties of 4,6-diiodopyrimidine?
4,6-diiodopyrimidine has a molecular weight of 331.88 g/mol, XLogP of 1.69, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diiodopyrimidine is sourced from PubChem (CID 15760295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).