About 4-butan-2-yl-1,3-oxazolidin-2-one
4-butan-2-yl-1,3-oxazolidin-2-one (PubChem CID 15761052) has the molecular formula C7H13NO2
and a molecular weight of 143.19 g/mol. Its IUPAC name is 4-butan-2-yl-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | 4-butan-2-yl-1,3-oxazolidin-2-one |
| PubChem CID | 15761052 |
| Molecular Formula | C7H13NO2 |
| Molecular Weight | 143.19 g/mol |
| Exact Mass | 143.09 |
| IUPAC Name | 4-butan-2-yl-1,3-oxazolidin-2-one |
| SMILES | CCC(C)C1COC(=O)N1 |
| InChI | InChI=1S/C7H13NO2/c1-3-5(2)6-4-10-7(9)8-6/h5-6H,3-4H2,1-2H3,(H,8,9) |
| InChIKey | ZHQQBKYJQYEFTG-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butan-2-yl-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-yl-1,3-oxazolidin-2-one?
The IUPAC name of 4-butan-2-yl-1,3-oxazolidin-2-one (CID 15761052) is 4-butan-2-yl-1,3-oxazolidin-2-one.
What is the SMILES notation for 4-butan-2-yl-1,3-oxazolidin-2-one?
The canonical SMILES for 4-butan-2-yl-1,3-oxazolidin-2-one is CCC(C)C1COC(=O)N1.
What is the InChIKey of 4-butan-2-yl-1,3-oxazolidin-2-one?
The InChIKey is ZHQQBKYJQYEFTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-3-5(2)6-4-10-7(9)8-6/h5-6H,3-4H2,1-2H3,(H,8,9).
What are the key properties of 4-butan-2-yl-1,3-oxazolidin-2-one?
4-butan-2-yl-1,3-oxazolidin-2-one has a molecular weight of 143.19 g/mol, XLogP of 1.14, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-yl-1,3-oxazolidin-2-one is sourced from PubChem (CID 15761052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).