C21H22N3PS — CID 15761701
N,N-diethyl-5-naphthalen-1-yl-3-phenyl-1,3,4,2-thiadiazaphosphol-2-amine (PubChem CID 15761701) has the molecular formula C21H22N3PS and a molecular weight of 379.47 g/mol. Its IUPAC name is N,N-diethyl-5-naphthalen-1-yl-3-phenyl-1,3,4,2-thiadiazaphosphol-2-amine.
| Compound Name | N,N-diethyl-5-naphthalen-1-yl-3-phenyl-1,3,4,2-thiadiazaphosphol-2-amine |
|---|---|
| PubChem CID | 15761701 |
| Molecular Formula | C21H22N3PS |
| Molecular Weight | 379.47 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N,N-diethyl-5-naphthalen-1-yl-3-phenyl-1,3,4,2-thiadiazaphosphol-2-amine |
| SMILES | CCN(CC)P1SC(c2cccc3ccccc23)=NN1c1ccccc1 |
| InChI | InChI=1S/C21H22N3PS/c1-3-23(4-2)25-24(18-13-6-5-7-14-18)22-21(26-25)20-16-10-12-17-11-8-9-15-19(17)20/h5-16H,3-4H2,1-2H3 |
| InChIKey | AIWVHZXJMQAOFZ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|