C18H15N5 — CID 15761739
5,6-diphenyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine (PubChem CID 15761739) has the molecular formula C18H15N5 and a molecular weight of 301.35 g/mol. Its IUPAC name is 5,6-diphenyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine.
| Compound Name | 5,6-diphenyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 15761739 |
| Molecular Formula | C18H15N5 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 5,6-diphenyl-7H-pyrrolo[2,3-d]pyrimidine-2,4-diamine |
| SMILES | Nc1nc(N)c2c(-c3ccccc3)c(-c3ccccc3)[nH]c2n1 |
| InChI | InChI=1S/C18H15N5/c19-16-14-13(11-7-3-1-4-8-11)15(12-9-5-2-6-10-12)21-17(14)23-18(20)22-16/h1-10H,(H5,19,20,21,22,23) |
| InChIKey | ALHDUYCWXQUVGC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |