C19H30O7 — CID 15762024
(3R,3aR,6R,6aR,8S,9bS)-6,8-dihydroxy-3-(2-methoxyethoxymethoxy)-3,6,9-trimethyl-4,5,6a,7,8,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one (PubChem CID 15762024) has the molecular formula C19H30O7 and a molecular weight of 370.44 g/mol. Its IUPAC name is (3R,3aR,6R,6aR,8S,9bS)-6,8-dihydroxy-3-(2-methoxyethoxymethoxy)-3,6,9-trimethyl-4,5,6a,7,8,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one.
| Compound Name | (3R,3aR,6R,6aR,8S,9bS)-6,8-dihydroxy-3-(2-methoxyethoxymethoxy)-3,6,9-trimethyl-4,5,6a,7,8,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 15762024 |
| Molecular Formula | C19H30O7 |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | (3R,3aR,6R,6aR,8S,9bS)-6,8-dihydroxy-3-(2-methoxyethoxymethoxy)-3,6,9-trimethyl-4,5,6a,7,8,9b-hexahydro-3aH-azuleno[4,5-b]furan-2-one |
| SMILES | COCCOCO[C@@]1(C)C(=O)O[C@@H]2C3=C(C)[C@@H](O)C[C@H]3[C@](C)(O)CC[C@H]21 |
| InChI | InChI=1S/C19H30O7/c1-11-14(20)9-13-15(11)16-12(5-6-18(13,2)22)19(3,17(21)26-16)25-10-24-8-7-23-4/h12-14,16,20,22H,5-10H2,1-4H3/t12-,13-,14+,16+,18-,19-/m1/s1 |
| InChIKey | GFJKSIUISKFOTD-DECAAPKMSA-N |
| XLogP | 1.17 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|