C18H31NO — CID 15762052
(3E,7E)-N,N,4,8,12-pentamethyltrideca-3,7,11-trienamide (PubChem CID 15762052) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is (3E,7E)-N,N,4,8,12-pentamethyltrideca-3,7,11-trienamide.
| Compound Name | (3E,7E)-N,N,4,8,12-pentamethyltrideca-3,7,11-trienamide |
|---|---|
| PubChem CID | 15762052 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | (3E,7E)-N,N,4,8,12-pentamethyltrideca-3,7,11-trienamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC(=O)N(C)C |
| InChI | InChI=1S/C18H31NO/c1-15(2)9-7-10-16(3)11-8-12-17(4)13-14-18(20)19(5)6/h9,11,13H,7-8,10,12,14H2,1-6H3/b16-11+,17-13+ |
| InChIKey | QICWMQCRRXIXJV-IUBLYSDUSA-N |
| XLogP | 4.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|