About bis(piperidin-1-ium);terephthalate
bis(piperidin-1-ium);terephthalate (PubChem CID 15763676) has the molecular formula C18H28N2O4
and a molecular weight of 336.43 g/mol. Its IUPAC name is bis(piperidin-1-ium);terephthalate.
Molecular Properties
| Compound Name | bis(piperidin-1-ium);terephthalate |
| PubChem CID | 15763676 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | bis(piperidin-1-ium);terephthalate |
| SMILES | C1CC[NH2+]CC1.C1CC[NH2+]CC1.O=C([O-])c1ccc(C(=O)[O-])cc1 |
| InChI | InChI=1S/C8H6O4.2C5H11N/c9-7(10)5-1-2-6(4-3-5)8(11)12;2*1-2-4-6-5-3-1/h1-4H,(H,9,10)(H,11,12);2*6H,1-5H2 |
| InChIKey | ISTQFNLCDWDJFO-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(piperidin-1-ium);terephthalate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(piperidin-1-ium);terephthalate?
The IUPAC name of bis(piperidin-1-ium);terephthalate (CID 15763676) is bis(piperidin-1-ium);terephthalate.
What is the SMILES notation for bis(piperidin-1-ium);terephthalate?
The canonical SMILES for bis(piperidin-1-ium);terephthalate is C1CC[NH2+]CC1.C1CC[NH2+]CC1.O=C([O-])c1ccc(C(=O)[O-])cc1.
What is the InChIKey of bis(piperidin-1-ium);terephthalate?
The InChIKey is ISTQFNLCDWDJFO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4.2C5H11N/c9-7(10)5-1-2-6(4-3-5)8(11)12;2*1-2-4-6-5-3-1/h1-4H,(H,9,10)(H,11,12);2*6H,1-5H2.
What are the key properties of bis(piperidin-1-ium);terephthalate?
bis(piperidin-1-ium);terephthalate has a molecular weight of 336.43 g/mol, XLogP of -2.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(piperidin-1-ium);terephthalate is sourced from PubChem (CID 15763676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).