About 7-hydroxy-10,10a-dihydrophenoxazin-3-one
7-hydroxy-10,10a-dihydrophenoxazin-3-one (PubChem CID 15764374) has the molecular formula C12H9NO3
and a molecular weight of 215.21 g/mol. Its IUPAC name is 7-hydroxy-10,10a-dihydrophenoxazin-3-one.
Molecular Properties
| Compound Name | 7-hydroxy-10,10a-dihydrophenoxazin-3-one |
| PubChem CID | 15764374 |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 7-hydroxy-10,10a-dihydrophenoxazin-3-one |
| SMILES | O=C1C=CC2Nc3ccc(O)cc3OC2=C1 |
| InChI | InChI=1S/C12H9NO3/c14-7-1-3-9-11(5-7)16-12-6-8(15)2-4-10(12)13-9/h1-6,9,13,15H |
| InChIKey | PXNYUBBNIIDWDS-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-10,10a-dihydrophenoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-10,10a-dihydrophenoxazin-3-one?
The IUPAC name of 7-hydroxy-10,10a-dihydrophenoxazin-3-one (CID 15764374) is 7-hydroxy-10,10a-dihydrophenoxazin-3-one.
What is the SMILES notation for 7-hydroxy-10,10a-dihydrophenoxazin-3-one?
The canonical SMILES for 7-hydroxy-10,10a-dihydrophenoxazin-3-one is O=C1C=CC2Nc3ccc(O)cc3OC2=C1.
What is the InChIKey of 7-hydroxy-10,10a-dihydrophenoxazin-3-one?
The InChIKey is PXNYUBBNIIDWDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3/c14-7-1-3-9-11(5-7)16-12-6-8(15)2-4-10(12)13-9/h1-6,9,13,15H.
What are the key properties of 7-hydroxy-10,10a-dihydrophenoxazin-3-one?
7-hydroxy-10,10a-dihydrophenoxazin-3-one has a molecular weight of 215.21 g/mol, XLogP of 1.59, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-10,10a-dihydrophenoxazin-3-one is sourced from PubChem (CID 15764374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).