About 4-nonylbenzenesulfonate
4-nonylbenzenesulfonate (PubChem CID 15764481) has the molecular formula C15H23O3S-
and a molecular weight of 283.41 g/mol. Its IUPAC name is 4-nonylbenzenesulfonate.
Molecular Properties
| Compound Name | 4-nonylbenzenesulfonate |
| PubChem CID | 15764481 |
| Molecular Formula | C15H23O3S- |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 4-nonylbenzenesulfonate |
| SMILES | CCCCCCCCCc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C15H24O3S/c1-2-3-4-5-6-7-8-9-14-10-12-15(13-11-14)19(16,17)18/h10-13H,2-9H2,1H3,(H,16,17,18)/p-1 |
| InChIKey | WPTFZDRBJGXAMT-UHFFFAOYSA-M |
| XLogP | 3.88 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 4-nonylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nonylbenzenesulfonate?
The IUPAC name of 4-nonylbenzenesulfonate (CID 15764481) is 4-nonylbenzenesulfonate.
What is the SMILES notation for 4-nonylbenzenesulfonate?
The canonical SMILES for 4-nonylbenzenesulfonate is CCCCCCCCCc1ccc(S(=O)(=O)[O-])cc1.
What is the InChIKey of 4-nonylbenzenesulfonate?
The InChIKey is WPTFZDRBJGXAMT-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H24O3S/c1-2-3-4-5-6-7-8-9-14-10-12-15(13-11-14)19(16,17)18/h10-13H,2-9H2,1H3,(H,16,17,18)/p-1.
What are the key properties of 4-nonylbenzenesulfonate?
4-nonylbenzenesulfonate has a molecular weight of 283.41 g/mol, XLogP of 3.88, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nonylbenzenesulfonate is sourced from PubChem (CID 15764481), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).