C20H28O4 — CID 15764839
(4Z,4aS,7S,8Z,11aR)-7-hydroxy-4-[(E)-4-hydroxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-1,4a,5,6,10,11a-hexahydrocyclonona[c]pyran-3-one (PubChem CID 15764839) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (4Z,4aS,7S,8Z,11aR)-7-hydroxy-4-[(E)-4-hydroxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-1,4a,5,6,10,11a-hexahydrocyclonona[c]pyran-3-one.
| Compound Name | (4Z,4aS,7S,8Z,11aR)-7-hydroxy-4-[(E)-4-hydroxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-1,4a,5,6,10,11a-hexahydrocyclonona[c]pyran-3-one |
|---|---|
| PubChem CID | 15764839 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (4Z,4aS,7S,8Z,11aR)-7-hydroxy-4-[(E)-4-hydroxy-4-methylpent-2-enylidene]-7-methyl-11-methylidene-1,4a,5,6,10,11a-hexahydrocyclonona[c]pyran-3-one |
| SMILES | C=C1C/C=C\[C@@](C)(O)CC[C@@H]2/C(=C/C=C/C(C)(C)O)C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C20H28O4/c1-14-7-5-11-20(4,23)12-9-15-16(8-6-10-19(2,3)22)18(21)24-13-17(14)15/h5-6,8,10-11,15,17,22-23H,1,7,9,12-13H2,2-4H3/b10-6+,11-5-,16-8-/t15-,17+,20-/m1/s1 |
| InChIKey | BLNSXPSESOVHJK-UWQZEHDFSA-N |
| XLogP | 3.08 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|