About 6-methylpyridin-2-amine
6-methylpyridin-2-amine (PubChem CID 15765) has the molecular formula C6H8N2
and a molecular weight of 108.14 g/mol. Its IUPAC name is 6-methylpyridin-2-amine.
Molecular Properties
| Compound Name | 6-methylpyridin-2-amine |
| PubChem CID | 15765 |
| Molecular Formula | C6H8N2 |
| Molecular Weight | 108.14 g/mol |
| Exact Mass | 108.07 |
| IUPAC Name | 6-methylpyridin-2-amine |
| SMILES | Cc1cccc(N)n1 |
| InChI | InChI=1S/C6H8N2/c1-5-3-2-4-6(7)8-5/h2-4H,1H3,(H2,7,8) |
| InChIKey | QUXLCYFNVNNRBE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 108.14 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-methylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methylpyridin-2-amine?
The IUPAC name of 6-methylpyridin-2-amine (CID 15765) is 6-methylpyridin-2-amine.
What is the SMILES notation for 6-methylpyridin-2-amine?
The canonical SMILES for 6-methylpyridin-2-amine is Cc1cccc(N)n1.
What is the InChIKey of 6-methylpyridin-2-amine?
The InChIKey is QUXLCYFNVNNRBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2/c1-5-3-2-4-6(7)8-5/h2-4H,1H3,(H2,7,8).
What are the key properties of 6-methylpyridin-2-amine?
6-methylpyridin-2-amine has a molecular weight of 108.14 g/mol, XLogP of 0.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methylpyridin-2-amine is sourced from PubChem (CID 15765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).