About 2-phenylcyclobutan-1-ol
2-phenylcyclobutan-1-ol (PubChem CID 15765220) has the molecular formula C10H12O
and a molecular weight of 148.20 g/mol. Its IUPAC name is 2-phenylcyclobutan-1-ol.
Molecular Properties
| Compound Name | 2-phenylcyclobutan-1-ol |
| PubChem CID | 15765220 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 2-phenylcyclobutan-1-ol |
| SMILES | OC1CCC1c1ccccc1 |
| InChI | InChI=1S/C10H12O/c11-10-7-6-9(10)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2 |
| InChIKey | FZJJHQLLQDVIPT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylcyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylcyclobutan-1-ol?
The IUPAC name of 2-phenylcyclobutan-1-ol (CID 15765220) is 2-phenylcyclobutan-1-ol.
What is the SMILES notation for 2-phenylcyclobutan-1-ol?
The canonical SMILES for 2-phenylcyclobutan-1-ol is OC1CCC1c1ccccc1.
What is the InChIKey of 2-phenylcyclobutan-1-ol?
The InChIKey is FZJJHQLLQDVIPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O/c11-10-7-6-9(10)8-4-2-1-3-5-8/h1-5,9-11H,6-7H2.
What are the key properties of 2-phenylcyclobutan-1-ol?
2-phenylcyclobutan-1-ol has a molecular weight of 148.20 g/mol, XLogP of 1.92, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylcyclobutan-1-ol is sourced from PubChem (CID 15765220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).