About hydrazine;5-nitro-1,2,4-triazol-3-one
hydrazine;5-nitro-1,2,4-triazol-3-one (PubChem CID 15765484) has the molecular formula C2H4N6O3
and a molecular weight of 160.09 g/mol. Its IUPAC name is hydrazine;5-nitro-1,2,4-triazol-3-one.
Molecular Properties
| Compound Name | hydrazine;5-nitro-1,2,4-triazol-3-one |
| PubChem CID | 15765484 |
| Molecular Formula | C2H4N6O3 |
| Molecular Weight | 160.09 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | hydrazine;5-nitro-1,2,4-triazol-3-one |
| SMILES | NN.O=C1N=NC([N+](=O)[O-])=N1 |
| InChI | InChI=1S/C2N4O3.H4N2/c7-2-3-1(4-5-2)6(8)9;1-2/h;1-2H2 |
| InChIKey | OIOSVUHGPVDRRA-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 149.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.09 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;5-nitro-1,2,4-triazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;5-nitro-1,2,4-triazol-3-one?
The IUPAC name of hydrazine;5-nitro-1,2,4-triazol-3-one (CID 15765484) is hydrazine;5-nitro-1,2,4-triazol-3-one.
What is the SMILES notation for hydrazine;5-nitro-1,2,4-triazol-3-one?
The canonical SMILES for hydrazine;5-nitro-1,2,4-triazol-3-one is NN.O=C1N=NC([N+](=O)[O-])=N1.
What is the InChIKey of hydrazine;5-nitro-1,2,4-triazol-3-one?
The InChIKey is OIOSVUHGPVDRRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2N4O3.H4N2/c7-2-3-1(4-5-2)6(8)9;1-2/h;1-2H2.
What are the key properties of hydrazine;5-nitro-1,2,4-triazol-3-one?
hydrazine;5-nitro-1,2,4-triazol-3-one has a molecular weight of 160.09 g/mol, XLogP of -0.98, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;5-nitro-1,2,4-triazol-3-one is sourced from PubChem (CID 15765484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).