C9H8O4 — CID 15765571
2-(5-oxo-2H-furan-3-yl)-2,3-dihydropyran-4-one (PubChem CID 15765571) has the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. Its IUPAC name is 2-(5-oxo-2H-furan-3-yl)-2,3-dihydropyran-4-one.
| Compound Name | 2-(5-oxo-2H-furan-3-yl)-2,3-dihydropyran-4-one |
|---|---|
| PubChem CID | 15765571 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 2-(5-oxo-2H-furan-3-yl)-2,3-dihydropyran-4-one |
| SMILES | O=C1C=COC(C2=CC(=O)OC2)C1 |
| InChI | InChI=1S/C9H8O4/c10-7-1-2-12-8(4-7)6-3-9(11)13-5-6/h1-3,8H,4-5H2 |
| InChIKey | FVXFGBPFNVIXLW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |