About 3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one
3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one (PubChem CID 15765572) has the molecular formula C12H18O4Si
and a molecular weight of 254.36 g/mol. Its IUPAC name is 3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one.
Molecular Properties
| Compound Name | 3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one |
| PubChem CID | 15765572 |
| Molecular Formula | C12H18O4Si |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one |
| SMILES | C[Si](C)(C)OC1=CCOC(C2=CC(=O)OC2)C1 |
| InChI | InChI=1S/C12H18O4Si/c1-17(2,3)16-10-4-5-14-11(7-10)9-6-12(13)15-8-9/h4,6,11H,5,7-8H2,1-3H3 |
| InChIKey | LAQLOQCDGXAHSB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one?
The IUPAC name of 3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one (CID 15765572) is 3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one.
What is the SMILES notation for 3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one?
The canonical SMILES for 3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one is C[Si](C)(C)OC1=CCOC(C2=CC(=O)OC2)C1.
What is the InChIKey of 3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one?
The InChIKey is LAQLOQCDGXAHSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O4Si/c1-17(2,3)16-10-4-5-14-11(7-10)9-6-12(13)15-8-9/h4,6,11H,5,7-8H2,1-3H3.
What are the key properties of 3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one?
3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one has a molecular weight of 254.36 g/mol, XLogP of 1.99, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-trimethylsilyloxy-3,6-dihydro-2H-pyran-2-yl)-2H-furan-5-one is sourced from PubChem (CID 15765572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).