About 5-methylsulfanylthieno[3,2-b]thiophene
5-methylsulfanylthieno[3,2-b]thiophene (PubChem CID 15766513) has the molecular formula C7H6S3
and a molecular weight of 186.33 g/mol. Its IUPAC name is 5-methylsulfanylthieno[3,2-b]thiophene.
Molecular Properties
| Compound Name | 5-methylsulfanylthieno[3,2-b]thiophene |
| PubChem CID | 15766513 |
| Molecular Formula | C7H6S3 |
| Molecular Weight | 186.33 g/mol |
| Exact Mass | 185.96 |
| IUPAC Name | 5-methylsulfanylthieno[3,2-b]thiophene |
| SMILES | CSc1cc2sccc2s1 |
| InChI | InChI=1S/C7H6S3/c1-8-7-4-6-5(10-7)2-3-9-6/h2-4H,1H3 |
| InChIKey | XQDBYIKFYZFVEP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.33 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methylsulfanylthieno[3,2-b]thiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfanylthieno[3,2-b]thiophene?
The IUPAC name of 5-methylsulfanylthieno[3,2-b]thiophene (CID 15766513) is 5-methylsulfanylthieno[3,2-b]thiophene.
What is the SMILES notation for 5-methylsulfanylthieno[3,2-b]thiophene?
The canonical SMILES for 5-methylsulfanylthieno[3,2-b]thiophene is CSc1cc2sccc2s1.
What is the InChIKey of 5-methylsulfanylthieno[3,2-b]thiophene?
The InChIKey is XQDBYIKFYZFVEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6S3/c1-8-7-4-6-5(10-7)2-3-9-6/h2-4H,1H3.
What are the key properties of 5-methylsulfanylthieno[3,2-b]thiophene?
5-methylsulfanylthieno[3,2-b]thiophene has a molecular weight of 186.33 g/mol, XLogP of 3.68, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfanylthieno[3,2-b]thiophene is sourced from PubChem (CID 15766513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).