C25H33F6NO2 — CID 15766804
(2E,4E)-11-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-methyl-N-(2-methylpropyl)undeca-2,4-dienamide (PubChem CID 15766804) has the molecular formula C25H33F6NO2 and a molecular weight of 493.53 g/mol. Its IUPAC name is (2E,4E)-11-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-methyl-N-(2-methylpropyl)undeca-2,4-dienamide.
| Compound Name | (2E,4E)-11-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-methyl-N-(2-methylpropyl)undeca-2,4-dienamide |
|---|---|
| PubChem CID | 15766804 |
| Molecular Formula | C25H33F6NO2 |
| Molecular Weight | 493.53 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | (2E,4E)-11-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-3-methyl-N-(2-methylpropyl)undeca-2,4-dienamide |
| SMILES | CC(/C=C/CCCCCCOCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)=C\C(=O)NCC(C)C |
| InChI | InChI=1S/C25H33F6NO2/c1-18(2)16-32-23(33)12-19(3)10-8-6-4-5-7-9-11-34-17-20-13-21(24(26,27)28)15-22(14-20)25(29,30)31/h8,10,12-15,18H,4-7,9,11,16-17H2,1-3H3,(H,32,33)/b10-8+,19-12+ |
| InChIKey | UWBDEJAJBFNURT-SLUIUKIVSA-N |
| XLogP | 7.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.53 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|