C19H27N — CID 15767674
1,13-dimethyl-10-(3-methylbut-2-enyl)-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene (PubChem CID 15767674) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is 1,13-dimethyl-10-(3-methylbut-2-enyl)-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene.
| Compound Name | 1,13-dimethyl-10-(3-methylbut-2-enyl)-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 15767674 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | 1,13-dimethyl-10-(3-methylbut-2-enyl)-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
| SMILES | CC(C)=CCN1CCC2(C)c3ccccc3CC1C2C |
| InChI | InChI=1S/C19H27N/c1-14(2)9-11-20-12-10-19(4)15(3)18(20)13-16-7-5-6-8-17(16)19/h5-9,15,18H,10-13H2,1-4H3 |
| InChIKey | LVXVKULGFQUGIV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|