C17H23N — CID 15767675
1,13-dimethyl-10-prop-2-enyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene (PubChem CID 15767675) has the molecular formula C17H23N and a molecular weight of 241.38 g/mol. Its IUPAC name is 1,13-dimethyl-10-prop-2-enyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene.
| Compound Name | 1,13-dimethyl-10-prop-2-enyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 15767675 |
| Molecular Formula | C17H23N |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1,13-dimethyl-10-prop-2-enyl-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
| SMILES | C=CCN1CCC2(C)c3ccccc3CC1C2C |
| InChI | InChI=1S/C17H23N/c1-4-10-18-11-9-17(3)13(2)16(18)12-14-7-5-6-8-15(14)17/h4-8,13,16H,1,9-12H2,2-3H3 |
| InChIKey | DCDPEUIZVWTSCT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|