C14H22O3 — CID 15767781
1-[(4S,4aR,8S)-4,8-dihydroxy-4a,8-dimethyl-1,4,5,6,7,8a-hexahydronaphthalen-2-yl]ethanone (PubChem CID 15767781) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is 1-[(4S,4aR,8S)-4,8-dihydroxy-4a,8-dimethyl-1,4,5,6,7,8a-hexahydronaphthalen-2-yl]ethanone.
| Compound Name | 1-[(4S,4aR,8S)-4,8-dihydroxy-4a,8-dimethyl-1,4,5,6,7,8a-hexahydronaphthalen-2-yl]ethanone |
|---|---|
| PubChem CID | 15767781 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | 1-[(4S,4aR,8S)-4,8-dihydroxy-4a,8-dimethyl-1,4,5,6,7,8a-hexahydronaphthalen-2-yl]ethanone |
| SMILES | CC(=O)C1=C[C@H](O)[C@]2(C)CCC[C@](C)(O)C2C1 |
| InChI | InChI=1S/C14H22O3/c1-9(15)10-7-11-13(2,12(16)8-10)5-4-6-14(11,3)17/h8,11-12,16-17H,4-7H2,1-3H3/t11?,12-,13+,14-/m0/s1 |
| InChIKey | WRNYMVWAPLPFJG-GSPSYOTPSA-N |
| XLogP | 1.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |