C14H32N2 — CID 15769079
1-N,2-N-ditert-butyl-3,3-dimethylbutane-1,2-diamine (PubChem CID 15769079) has the molecular formula C14H32N2 and a molecular weight of 228.42 g/mol. Its IUPAC name is 1-N,2-N-ditert-butyl-3,3-dimethylbutane-1,2-diamine.
| Compound Name | 1-N,2-N-ditert-butyl-3,3-dimethylbutane-1,2-diamine |
|---|---|
| PubChem CID | 15769079 |
| Molecular Formula | C14H32N2 |
| Molecular Weight | 228.42 g/mol |
| Exact Mass | 228.26 |
| IUPAC Name | 1-N,2-N-ditert-butyl-3,3-dimethylbutane-1,2-diamine |
| SMILES | CC(C)(C)NCC(NC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H32N2/c1-12(2,3)11(16-14(7,8)9)10-15-13(4,5)6/h11,15-16H,10H2,1-9H3 |
| InChIKey | KMZYAKIMZLVSST-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |