C13H5F17 — CID 15769647
1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)cyclopenta-1,3-diene (PubChem CID 15769647) has the molecular formula C13H5F17 and a molecular weight of 484.15 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)cyclopenta-1,3-diene.
| Compound Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 15769647 |
| Molecular Formula | C13H5F17 |
| Molecular Weight | 484.15 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)cyclopenta-1,3-diene |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1=CC=CC1 |
| InChI | InChI=1S/C13H5F17/c14-6(15,5-3-1-2-4-5)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h1-3H,4H2 |
| InChIKey | MTMAHERBDLVGME-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.15 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|