About CID 15771519
CID 15771519 (PubChem CID 15771519) has the molecular formula C8H12Bi
and a molecular weight of 317.16 g/mol.
Molecular Properties
| Compound Name | CID 15771519 |
| PubChem CID | 15771519 |
| Molecular Formula | C8H12Bi |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | — |
| SMILES | CC1=C(C)C(C)=C(C)[Bi]1 |
| InChI | InChI=1S/C8H12.Bi/c1-5-7(3)8(4)6-2;/h1-4H3; |
| InChIKey | KPPQHTYYYGJTJA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze CID 15771519 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 15771519?
The IUPAC name of CID 15771519 (CID 15771519) is not available.
What is the SMILES notation for CID 15771519?
The canonical SMILES for CID 15771519 is CC1=C(C)C(C)=C(C)[Bi]1.
What is the InChIKey of CID 15771519?
The InChIKey is KPPQHTYYYGJTJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12.Bi/c1-5-7(3)8(4)6-2;/h1-4H3;.
What are the key properties of CID 15771519?
CID 15771519 has a molecular weight of 317.16 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 15771519 is sourced from PubChem (CID 15771519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).