About bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+)
bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+) (PubChem CID 15771952) has the molecular formula C31H39CrNP2Si2
and a molecular weight of 595.78 g/mol. Its IUPAC name is bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+).
Molecular Properties
| Compound Name | bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+) |
| PubChem CID | 15771952 |
| Molecular Formula | C31H39CrNP2Si2 |
| Molecular Weight | 595.78 g/mol |
| Exact Mass | 595.15 |
| IUPAC Name | bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+) |
| SMILES | C[Si](C)(CP(c1ccccc1)c1ccccc1)[N-][Si](C)(C)CP(c1ccccc1)c1ccccc1.[CH3-].[Cr+2] |
| InChI | InChI=1S/C30H36NP2Si2.CH3.Cr/c1-34(2,25-32(27-17-9-5-10-18-27)28-19-11-6-12-20-28)31-35(3,4)26-33(29-21-13-7-14-22-29)30-23-15-8-16-24-30;;/h5-24H,25-26H2,1-4H3;1H3;/q2*-1;+2 |
| InChIKey | FMOPZZNFULHDOT-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 595.78 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+)?
The IUPAC name of bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+) (CID 15771952) is bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+).
What is the SMILES notation for bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+)?
The canonical SMILES for bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+) is C[Si](C)(CP(c1ccccc1)c1ccccc1)[N-][Si](C)(C)CP(c1ccccc1)c1ccccc1.[CH3-].[Cr+2].
What is the InChIKey of bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+)?
The InChIKey is FMOPZZNFULHDOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H36NP2Si2.CH3.Cr/c1-34(2,25-32(27-17-9-5-10-18-27)28-19-11-6-12-20-28)31-35(3,4)26-33(29-21-13-7-14-22-29)30-23-15-8-16-24-30;;/h5-24H,25-26H2,1-4H3;1H3;/q2*-1;+2.
What are the key properties of bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+)?
bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+) has a molecular weight of 595.78 g/mol, XLogP of 7.56, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis[diphenylphosphanylmethyl(dimethyl)silyl]azanide;carbanide;chromium(2+) is sourced from PubChem (CID 15771952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).