About 1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+)
1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+) (PubChem CID 15772851) has the molecular formula C32H22N6O2Ru+2
and a molecular weight of 623.64 g/mol. Its IUPAC name is 1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+).
Molecular Properties
| Compound Name | 1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+) |
| PubChem CID | 15772851 |
| Molecular Formula | C32H22N6O2Ru+2 |
| Molecular Weight | 623.64 g/mol |
| Exact Mass | 624.08 |
| IUPAC Name | 1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+) |
| SMILES | O=C1C(=O)c2cccnc2-c2ncccc21.[Ru+2].c1ccc(-c2ccccn2)nc1.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C12H6N2O2.2C10H8N2.Ru/c15-11-7-3-1-5-13-9(7)10-8(12(11)16)4-2-6-14-10;2*1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h1-6H;2*1-8H;/q;;;+2 |
| InChIKey | SKVYXDDMDRFCME-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 111.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 623.64 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+)?
The IUPAC name of 1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+) (CID 15772851) is 1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+).
What is the SMILES notation for 1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+)?
The canonical SMILES for 1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+) is O=C1C(=O)c2cccnc2-c2ncccc21.[Ru+2].c1ccc(-c2ccccn2)nc1.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of 1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+)?
The InChIKey is SKVYXDDMDRFCME-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6N2O2.2C10H8N2.Ru/c15-11-7-3-1-5-13-9(7)10-8(12(11)16)4-2-6-14-10;2*1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h1-6H;2*1-8H;/q;;;+2.
What are the key properties of 1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+)?
1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+) has a molecular weight of 623.64 g/mol, XLogP of 5.81, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1,10-phenanthroline-5,6-dione;bis(2-pyridin-2-ylpyridine);ruthenium(2+) is sourced from PubChem (CID 15772851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).