C5H6N4O3 — CID 15773209
4,5,7,9-tetrahydro-3H-purine-2,6,8-trione (PubChem CID 15773209) has the molecular formula C5H6N4O3 and a molecular weight of 170.13 g/mol. Its IUPAC name is 4,5,7,9-tetrahydro-3H-purine-2,6,8-trione.
| Compound Name | 4,5,7,9-tetrahydro-3H-purine-2,6,8-trione |
|---|---|
| PubChem CID | 15773209 |
| Molecular Formula | C5H6N4O3 |
| Molecular Weight | 170.13 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 4,5,7,9-tetrahydro-3H-purine-2,6,8-trione |
| SMILES | O=C1NC(=O)C2NC(=O)NC2N1 |
| InChI | InChI=1S/C5H6N4O3/c10-3-1-2(7-4(11)6-1)8-5(12)9-3/h1-2H,(H2,6,7,11)(H2,8,9,10,12) |
| InChIKey | TVWHNULVHGKJHS-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.13 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |