About 2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide
2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide (PubChem CID 15773582) has the molecular formula C11H28N2Si2
and a molecular weight of 244.53 g/mol. Its IUPAC name is 2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide.
Molecular Properties
| Compound Name | 2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide |
| PubChem CID | 15773582 |
| Molecular Formula | C11H28N2Si2 |
| Molecular Weight | 244.53 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide |
| SMILES | CC(C)(C)/C(=N/[Si](C)(C)C)N[Si](C)(C)C |
| InChI | InChI=1S/C11H28N2Si2/c1-11(2,3)10(12-14(4,5)6)13-15(7,8)9/h1-9H3,(H,12,13) |
| InChIKey | IAOQUTVFHFUEBR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide?
The IUPAC name of 2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide (CID 15773582) is 2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide.
What is the SMILES notation for 2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide?
The canonical SMILES for 2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide is CC(C)(C)/C(=N/[Si](C)(C)C)N[Si](C)(C)C.
What is the InChIKey of 2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide?
The InChIKey is IAOQUTVFHFUEBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H28N2Si2/c1-11(2,3)10(12-14(4,5)6)13-15(7,8)9/h1-9H3,(H,12,13).
What are the key properties of 2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide?
2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide has a molecular weight of 244.53 g/mol, XLogP of 3.69, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N,N'-bis(trimethylsilyl)propanimidamide is sourced from PubChem (CID 15773582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).