About 2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene
2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene (PubChem CID 15775107) has the molecular formula C11H18O
and a molecular weight of 166.26 g/mol. Its IUPAC name is 2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene.
Molecular Properties
| Compound Name | 2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene |
| PubChem CID | 15775107 |
| Molecular Formula | C11H18O |
| Molecular Weight | 166.26 g/mol |
| Exact Mass | 166.14 |
| IUPAC Name | 2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene |
| SMILES | COCC1=CCC2CC1C2(C)C |
| InChI | InChI=1S/C11H18O/c1-11(2)9-5-4-8(7-12-3)10(11)6-9/h4,9-10H,5-7H2,1-3H3 |
| InChIKey | GMYAZJHVKQKHSD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
The IUPAC name of 2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene (CID 15775107) is 2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene.
What is the SMILES notation for 2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
The canonical SMILES for 2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene is COCC1=CCC2CC1C2(C)C.
What is the InChIKey of 2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
The InChIKey is GMYAZJHVKQKHSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O/c1-11(2)9-5-4-8(7-12-3)10(11)6-9/h4,9-10H,5-7H2,1-3H3.
What are the key properties of 2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene?
2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene has a molecular weight of 166.26 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-6,6-dimethylbicyclo[3.1.1]hept-2-ene is sourced from PubChem (CID 15775107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).