C10H17N — CID 15775951
N-(2-cyclopenta-2,4-dien-1-ylethyl)propan-2-amine (PubChem CID 15775951) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is N-(2-cyclopenta-2,4-dien-1-ylethyl)propan-2-amine.
| Compound Name | N-(2-cyclopenta-2,4-dien-1-ylethyl)propan-2-amine |
|---|---|
| PubChem CID | 15775951 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | N-(2-cyclopenta-2,4-dien-1-ylethyl)propan-2-amine |
| SMILES | CC(C)NCCC1C=CC=C1 |
| InChI | InChI=1S/C10H17N/c1-9(2)11-8-7-10-5-3-4-6-10/h3-6,9-11H,7-8H2,1-2H3 |
| InChIKey | LZSILLRVVBNLGQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |