About dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane
dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane (PubChem CID 15776842) has the molecular formula C12H14Cl2SiZr
and a molecular weight of 348.46 g/mol. Its IUPAC name is dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane.
Molecular Properties
| Compound Name | dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane |
| PubChem CID | 15776842 |
| Molecular Formula | C12H14Cl2SiZr |
| Molecular Weight | 348.46 g/mol |
| Exact Mass | 345.93 |
| IUPAC Name | dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane |
| SMILES | C[Si](C)([c-]1cccc1)[c-]1cccc1.Cl[Zr+2]Cl |
| InChI | InChI=1S/C12H14Si.2ClH.Zr/c1-13(2,11-7-3-4-8-11)12-9-5-6-10-12;;;/h3-10H,1-2H3;2*1H;/q-2;;;+4/p-2 |
| InChIKey | BPBDABBQIOBAHM-UHFFFAOYSA-L |
| XLogP | 3.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane?
The IUPAC name of dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane (CID 15776842) is dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane.
What is the SMILES notation for dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane?
The canonical SMILES for dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane is C[Si](C)([c-]1cccc1)[c-]1cccc1.Cl[Zr+2]Cl.
What is the InChIKey of dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane?
The InChIKey is BPBDABBQIOBAHM-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H14Si.2ClH.Zr/c1-13(2,11-7-3-4-8-11)12-9-5-6-10-12;;;/h3-10H,1-2H3;2*1H;/q-2;;;+4/p-2.
What are the key properties of dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane?
dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane has a molecular weight of 348.46 g/mol, XLogP of 3.32, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorozirconium(2+);di(cyclopenta-2,4-dien-1-yl)-dimethylsilane is sourced from PubChem (CID 15776842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).