C22H36OSi — CID 15778100
(6R,7R)-6-prop-1-ynyl-6-trimethylsilylhexadeca-1,8,9,15-tetraen-7-ol (PubChem CID 15778100) has the molecular formula C22H36OSi and a molecular weight of 344.62 g/mol. Its IUPAC name is (6R,7R)-6-prop-1-ynyl-6-trimethylsilylhexadeca-1,8,9,15-tetraen-7-ol.
| Compound Name | (6R,7R)-6-prop-1-ynyl-6-trimethylsilylhexadeca-1,8,9,15-tetraen-7-ol |
|---|---|
| PubChem CID | 15778100 |
| Molecular Formula | C22H36OSi |
| Molecular Weight | 344.62 g/mol |
| Exact Mass | 344.25 |
| IUPAC Name | (6R,7R)-6-prop-1-ynyl-6-trimethylsilylhexadeca-1,8,9,15-tetraen-7-ol |
| SMILES | C=CCCCCC=C=C[C@@H](O)[C@](C#CC)(CCCC=C)[Si](C)(C)C |
| InChI | InChI=1S/C22H36OSi/c1-7-10-12-13-14-15-16-18-21(23)22(19-9-3,24(4,5)6)20-17-11-8-2/h7-8,15,18,21,23H,1-2,10-14,17,20H2,3-6H3/t16?,21-,22+/m1/s1 |
| InChIKey | MDKMOIAHOMQGDR-JLYBBMSXSA-N |
| XLogP | 6.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.62 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|