About 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene
1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene (PubChem CID 15778113) has the molecular formula C25H27BrO6
and a molecular weight of 503.39 g/mol. Its IUPAC name is 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene.
Molecular Properties
| Compound Name | 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene |
| PubChem CID | 15778113 |
| Molecular Formula | C25H27BrO6 |
| Molecular Weight | 503.39 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene |
| SMILES | COc1cc(COc2cc(CBr)cc(OCc3cc(OC)cc(OC)c3)c2)cc(OC)c1 |
| InChI | InChI=1S/C25H27BrO6/c1-27-20-7-18(8-21(11-20)28-2)15-31-24-5-17(14-26)6-25(13-24)32-16-19-9-22(29-3)12-23(10-19)30-4/h5-13H,14-16H2,1-4H3 |
| InChIKey | RLACLNXCSSBIKS-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.39 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene?
The IUPAC name of 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene (CID 15778113) is 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene.
What is the SMILES notation for 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene?
The canonical SMILES for 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene is COc1cc(COc2cc(CBr)cc(OCc3cc(OC)cc(OC)c3)c2)cc(OC)c1.
What is the InChIKey of 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene?
The InChIKey is RLACLNXCSSBIKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27BrO6/c1-27-20-7-18(8-21(11-20)28-2)15-31-24-5-17(14-26)6-25(13-24)32-16-19-9-22(29-3)12-23(10-19)30-4/h5-13H,14-16H2,1-4H3.
What are the key properties of 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene?
1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene has a molecular weight of 503.39 g/mol, XLogP of 5.77, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(bromomethyl)-3,5-bis[(3,5-dimethoxyphenyl)methoxy]benzene is sourced from PubChem (CID 15778113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).