C17H7NO3 — CID 15778417
8,15-dioxo-14-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-16-carbonitrile (PubChem CID 15778417) has the molecular formula C17H7NO3 and a molecular weight of 273.25 g/mol. Its IUPAC name is 8,15-dioxo-14-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-16-carbonitrile.
| Compound Name | 8,15-dioxo-14-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-16-carbonitrile |
|---|---|
| PubChem CID | 15778417 |
| Molecular Formula | C17H7NO3 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 8,15-dioxo-14-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12-heptaene-16-carbonitrile |
| SMILES | N#Cc1c2c3c(cccc3oc1=O)C(=O)c1ccccc1-2 |
| InChI | InChI=1S/C17H7NO3/c18-8-12-14-9-4-1-2-5-10(9)16(19)11-6-3-7-13(15(11)14)21-17(12)20/h1-7H |
| InChIKey | CNYQHKWILIPAOJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 71.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|