About trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate
trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate (PubChem CID 15778625) has the molecular formula C12H20O2S
and a molecular weight of 228.36 g/mol. Its IUPAC name is trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate.
Molecular Properties
| Compound Name | trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate |
| PubChem CID | 15778625 |
| Molecular Formula | C12H20O2S |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@]1(C)C[C@@]1(C)/C(C)=C/SC |
| InChI | InChI=1S/C12H20O2S/c1-6-14-10(13)12(4)8-11(12,3)9(2)7-15-5/h7H,6,8H2,1-5H3/b9-7+/t11-,12-/m0/s1 |
| InChIKey | XBWMBOPZNRXTBS-JONLBCGYSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate?
The IUPAC name of trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate (CID 15778625) is trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate.
What is the SMILES notation for trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate?
The canonical SMILES for trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate is CCOC(=O)[C@]1(C)C[C@@]1(C)/C(C)=C/SC.
What is the InChIKey of trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate?
The InChIKey is XBWMBOPZNRXTBS-JONLBCGYSA-N. The full InChI is InChI=1S/C12H20O2S/c1-6-14-10(13)12(4)8-11(12,3)9(2)7-15-5/h7H,6,8H2,1-5H3/b9-7+/t11-,12-/m0/s1.
What are the key properties of trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate?
trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate has a molecular weight of 228.36 g/mol, XLogP of 3.23, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for trans-ethyl (1R,2R)-1,2-dimethyl-2-[(E)-1-methylsulfanylprop-1-en-2-yl]cyclopropane-1-carboxylate is sourced from PubChem (CID 15778625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).