C24H27NO6S — CID 15778714
methyl (2S)-2-[(4-methylphenyl)sulfonyl-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-ynyl]amino]-3-phenylpropanoate (PubChem CID 15778714) has the molecular formula C24H27NO6S and a molecular weight of 457.55 g/mol. Its IUPAC name is methyl (2S)-2-[(4-methylphenyl)sulfonyl-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-ynyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[(4-methylphenyl)sulfonyl-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-ynyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 15778714 |
| Molecular Formula | C24H27NO6S |
| Molecular Weight | 457.55 g/mol |
| Exact Mass | 457.16 |
| IUPAC Name | methyl (2S)-2-[(4-methylphenyl)sulfonyl-[3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-ynyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)N(C#CC(=O)OC(C)(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C24H27NO6S/c1-18-11-13-20(14-12-18)32(28,29)25(16-15-22(26)31-24(2,3)4)21(23(27)30-5)17-19-9-7-6-8-10-19/h6-14,21H,17H2,1-5H3/t21-/m0/s1 |
| InChIKey | DEUZRWRTBUPBHK-NRFANRHFSA-N |
| XLogP | 3.07 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|