C24H22ClN3O2 — CID 15780499
8-chloro-11-[1-[(1-oxidopyridin-1-ium-4-yl)methyl]piperidin-4-ylidene]-5H-[1]benzoxepino[4,3-b]pyridine (PubChem CID 15780499) has the molecular formula C24H22ClN3O2 and a molecular weight of 419.91 g/mol. Its IUPAC name is 8-chloro-11-[1-[(1-oxidopyridin-1-ium-4-yl)methyl]piperidin-4-ylidene]-5H-[1]benzoxepino[4,3-b]pyridine.
| Compound Name | 8-chloro-11-[1-[(1-oxidopyridin-1-ium-4-yl)methyl]piperidin-4-ylidene]-5H-[1]benzoxepino[4,3-b]pyridine |
|---|---|
| PubChem CID | 15780499 |
| Molecular Formula | C24H22ClN3O2 |
| Molecular Weight | 419.91 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 8-chloro-11-[1-[(1-oxidopyridin-1-ium-4-yl)methyl]piperidin-4-ylidene]-5H-[1]benzoxepino[4,3-b]pyridine |
| SMILES | [O-][n+]1ccc(CN2CCC(=C3c4ccc(Cl)cc4OCc4cccnc43)CC2)cc1 |
| InChI | InChI=1S/C24H22ClN3O2/c25-20-3-4-21-22(14-20)30-16-19-2-1-9-26-24(19)23(21)18-7-10-27(11-8-18)15-17-5-12-28(29)13-6-17/h1-6,9,12-14H,7-8,10-11,15-16H2 |
| InChIKey | MJYHZIURLLVBNU-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.91 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|