C12H16 — CID 15781414
pentacyclo[9.1.0.01,3.04,6.07,9]dodecane (PubChem CID 15781414) has the molecular formula C12H16 and a molecular weight of 160.26 g/mol. Its IUPAC name is pentacyclo[9.1.0.01,3.04,6.07,9]dodecane.
| Compound Name | pentacyclo[9.1.0.01,3.04,6.07,9]dodecane |
|---|---|
| PubChem CID | 15781414 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | pentacyclo[9.1.0.01,3.04,6.07,9]dodecane |
| SMILES | C1C2CC3CC34CC4C3CC3C12 |
| InChI | InChI=1S/C12H16/c1-6-2-8(6)9-3-10(9)11-5-12(11)4-7(1)12/h6-11H,1-5H2 |
| InChIKey | QQVYYJXOYVZEDI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |