About pentacyclo[9.1.0.01,3.04,6.07,9]dodecane
pentacyclo[9.1.0.01,3.04,6.07,9]dodecane (PubChem CID 15781414) has the molecular formula C12H16
and a molecular weight of 160.26 g/mol. Its IUPAC name is pentacyclo[9.1.0.01,3.04,6.07,9]dodecane.
Molecular Properties
| Compound Name | pentacyclo[9.1.0.01,3.04,6.07,9]dodecane |
| PubChem CID | 15781414 |
| Molecular Formula | C12H16 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.13 |
| IUPAC Name | pentacyclo[9.1.0.01,3.04,6.07,9]dodecane |
| SMILES | C1C2CC3CC34CC4C3CC3C12 |
| InChI | InChI=1S/C12H16/c1-6-2-8(6)9-3-10(9)11-5-12(11)4-7(1)12/h6-11H,1-5H2 |
| InChIKey | QQVYYJXOYVZEDI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze pentacyclo[9.1.0.01,3.04,6.07,9]dodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentacyclo[9.1.0.01,3.04,6.07,9]dodecane?
The IUPAC name of pentacyclo[9.1.0.01,3.04,6.07,9]dodecane (CID 15781414) is pentacyclo[9.1.0.01,3.04,6.07,9]dodecane.
What is the SMILES notation for pentacyclo[9.1.0.01,3.04,6.07,9]dodecane?
The canonical SMILES for pentacyclo[9.1.0.01,3.04,6.07,9]dodecane is C1C2CC3CC34CC4C3CC3C12.
What is the InChIKey of pentacyclo[9.1.0.01,3.04,6.07,9]dodecane?
The InChIKey is QQVYYJXOYVZEDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16/c1-6-2-8(6)9-3-10(9)11-5-12(11)4-7(1)12/h6-11H,1-5H2.
What are the key properties of pentacyclo[9.1.0.01,3.04,6.07,9]dodecane?
pentacyclo[9.1.0.01,3.04,6.07,9]dodecane has a molecular weight of 160.26 g/mol, XLogP of 2.69, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentacyclo[9.1.0.01,3.04,6.07,9]dodecane is sourced from PubChem (CID 15781414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).