C18H9O4P — CID 15782315
8,14,22-trioxa-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene 1-oxide (PubChem CID 15782315) has the molecular formula C18H9O4P and a molecular weight of 320.24 g/mol. Its IUPAC name is 8,14,22-trioxa-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene 1-oxide.
| Compound Name | 8,14,22-trioxa-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene 1-oxide |
|---|---|
| PubChem CID | 15782315 |
| Molecular Formula | C18H9O4P |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 8,14,22-trioxa-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2,4,6,9(21),10,12,15,17,19-nonaene 1-oxide |
| SMILES | O=P12c3c4cccc3Oc3cccc(c31)Oc1cccc(c12)O4 |
| InChI | InChI=1S/C18H9O4P/c19-23-16-10-4-1-5-11(16)21-13-7-3-9-15(18(13)23)22-14-8-2-6-12(20-10)17(14)23/h1-9H |
| InChIKey | FLYHORNXKUJASF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|