About [2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite
[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite (PubChem CID 15782871) has the molecular formula C15H8Cl2F2O2S
and a molecular weight of 361.20 g/mol. Its IUPAC name is [2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite.
Molecular Properties
| Compound Name | [2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite |
| PubChem CID | 15782871 |
| Molecular Formula | C15H8Cl2F2O2S |
| Molecular Weight | 361.20 g/mol |
| Exact Mass | 359.96 |
| IUPAC Name | [2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite |
| SMILES | O=C(c1ccc(F)cc1)C(Cl)(SCl)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H8Cl2F2O2S/c16-15(22-17,13(20)9-1-5-11(18)6-2-9)14(21)10-3-7-12(19)8-4-10/h1-8H |
| InChIKey | JQZHIAGWUSWNIW-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.20 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite?
The IUPAC name of [2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite (CID 15782871) is [2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite.
What is the SMILES notation for [2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite?
The canonical SMILES for [2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite is O=C(c1ccc(F)cc1)C(Cl)(SCl)C(=O)c1ccc(F)cc1.
What is the InChIKey of [2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite?
The InChIKey is JQZHIAGWUSWNIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8Cl2F2O2S/c16-15(22-17,13(20)9-1-5-11(18)6-2-9)14(21)10-3-7-12(19)8-4-10/h1-8H.
What are the key properties of [2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite?
[2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite has a molecular weight of 361.20 g/mol, XLogP of 4.85, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-chloro-1,3-bis(4-fluorophenyl)-1,3-dioxopropan-2-yl] thiohypochlorite is sourced from PubChem (CID 15782871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).